C27H50O3 — CID 56636860
(1S,2R,3S)-3-(4,4-dimethyloctyl)-2-[7-[(2R)-oxan-2-yl]oxyhept-2-enyl]cyclopentan-1-ol (PubChem CID 56636860) has the molecular formula C27H50O3 and a molecular weight of 422.69 g/mol. Its IUPAC name is (1S,2R,3S)-3-(4,4-dimethyloctyl)-2-[7-[(2R)-oxan-2-yl]oxyhept-2-enyl]cyclopentan-1-ol.
| Compound Name | (1S,2R,3S)-3-(4,4-dimethyloctyl)-2-[7-[(2R)-oxan-2-yl]oxyhept-2-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 56636860 |
| Molecular Formula | C27H50O3 |
| Molecular Weight | 422.69 g/mol |
| Exact Mass | 422.38 |
| IUPAC Name | (1S,2R,3S)-3-(4,4-dimethyloctyl)-2-[7-[(2R)-oxan-2-yl]oxyhept-2-enyl]cyclopentan-1-ol |
| SMILES | CCCCC(C)(C)CCC[C@H]1CC[C@H](O)[C@@H]1CC=CCCCCO[C@@H]1CCCCO1 |
| InChI | InChI=1S/C27H50O3/c1-4-5-19-27(2,3)20-13-14-23-17-18-25(28)24(23)15-9-7-6-8-11-21-29-26-16-10-12-22-30-26/h7,9,23-26,28H,4-6,8,10-22H2,1-3H3/t23-,24+,25-,26-/m0/s1 |
| InChIKey | ODNKOQREORHGKR-QYOOZWMWSA-N |
| XLogP | 7.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.69 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|