C17H28O3 — CID 18640811
(1S,2S)-2-[7-(oxan-2-yloxy)hept-1-en-3-yl]cyclopent-3-en-1-ol (PubChem CID 18640811) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (1S,2S)-2-[7-(oxan-2-yloxy)hept-1-en-3-yl]cyclopent-3-en-1-ol.
| Compound Name | (1S,2S)-2-[7-(oxan-2-yloxy)hept-1-en-3-yl]cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 18640811 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (1S,2S)-2-[7-(oxan-2-yloxy)hept-1-en-3-yl]cyclopent-3-en-1-ol |
| SMILES | C=CC(CCCCOC1CCCCO1)[C@@H]1C=CC[C@@H]1O |
| InChI | InChI=1S/C17H28O3/c1-2-14(15-9-7-10-16(15)18)8-3-5-12-19-17-11-4-6-13-20-17/h2,7,9,14-18H,1,3-6,8,10-13H2/t14?,15-,16-,17?/m0/s1 |
| InChIKey | BXGPLTOXCYAIMK-YZUHTNEWSA-N |
| XLogP | 3.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|