C23H40O4 — CID 57039430
3a-[4,4-dimethyl-8-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 57039430) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 3a-[4,4-dimethyl-8-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | 3a-[4,4-dimethyl-8-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 57039430 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 3a-[4,4-dimethyl-8-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CC(C)(CC=CC12CCCC1(C)OC(O)C2)CCCCOC1CCCCO1 |
| InChI | InChI=1S/C23H40O4/c1-21(2,11-5-7-17-26-20-10-4-6-16-25-20)12-8-14-23-15-9-13-22(23,3)27-19(24)18-23/h8,14,19-20,24H,4-7,9-13,15-18H2,1-3H3 |
| InChIKey | NYQJEBWEYHFGEP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|