C25H45BrO2 — CID 22808738
2-[(E,3S)-1-[(1S,2S)-2-(7-bromoheptyl)cyclopentyl]oct-1-en-3-yl]oxyoxane (PubChem CID 22808738) has the molecular formula C25H45BrO2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-[(E,3S)-1-[(1S,2S)-2-(7-bromoheptyl)cyclopentyl]oct-1-en-3-yl]oxyoxane.
| Compound Name | 2-[(E,3S)-1-[(1S,2S)-2-(7-bromoheptyl)cyclopentyl]oct-1-en-3-yl]oxyoxane |
|---|---|
| PubChem CID | 22808738 |
| Molecular Formula | C25H45BrO2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 2-[(E,3S)-1-[(1S,2S)-2-(7-bromoheptyl)cyclopentyl]oct-1-en-3-yl]oxyoxane |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1CCC[C@@H]1CCCCCCCBr)OC1CCCCO1 |
| InChI | InChI=1S/C25H45BrO2/c1-2-3-7-16-24(28-25-17-9-11-21-27-25)19-18-23-15-12-14-22(23)13-8-5-4-6-10-20-26/h18-19,22-25H,2-17,20-21H2,1H3/b19-18+/t22-,23+,24-,25?/m0/s1 |
| InChIKey | BILQLEQOWUPVDH-SDXYGMICSA-N |
| XLogP | 8.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|