C30H50O4 — CID 57276672
2-[7-[(1R,2S)-2-oct-1-enylcyclopentyl]-1-(oxan-2-yloxy)hepta-4,5-dienoxy]oxane (PubChem CID 57276672) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is 2-[7-[(1R,2S)-2-oct-1-enylcyclopentyl]-1-(oxan-2-yloxy)hepta-4,5-dienoxy]oxane.
| Compound Name | 2-[7-[(1R,2S)-2-oct-1-enylcyclopentyl]-1-(oxan-2-yloxy)hepta-4,5-dienoxy]oxane |
|---|---|
| PubChem CID | 57276672 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | 2-[7-[(1R,2S)-2-oct-1-enylcyclopentyl]-1-(oxan-2-yloxy)hepta-4,5-dienoxy]oxane |
| SMILES | CCCCCCC=C[C@H]1CCC[C@@H]1CC=C=CCCC(OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C30H50O4/c1-2-3-4-5-6-9-17-26-19-16-20-27(26)18-10-7-8-11-23-30(33-28-21-12-14-24-31-28)34-29-22-13-15-25-32-29/h8-10,17,26-30H,2-6,11-16,18-25H2,1H3/t7?,26-,27-,28?,29?,30?/m0/s1 |
| InChIKey | SLBXGNNIAKVAQO-YKTYOWKBSA-N |
| XLogP | 8.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|