C16H14F2O — CID 107512076
2-(2,3-difluoro-4-methylphenyl)-1,3-dihydroinden-2-ol (PubChem CID 107512076) has the molecular formula C16H14F2O and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-methylphenyl)-1,3-dihydroinden-2-ol.
| Compound Name | 2-(2,3-difluoro-4-methylphenyl)-1,3-dihydroinden-2-ol |
|---|---|
| PubChem CID | 107512076 |
| Molecular Formula | C16H14F2O |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-(2,3-difluoro-4-methylphenyl)-1,3-dihydroinden-2-ol |
| SMILES | Cc1ccc(C2(O)Cc3ccccc3C2)c(F)c1F |
| InChI | InChI=1S/C16H14F2O/c1-10-6-7-13(15(18)14(10)17)16(19)8-11-4-2-3-5-12(11)9-16/h2-7,19H,8-9H2,1H3 |
| InChIKey | VTQURLJORAGQSS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |