C13H14F2O — CID 107512381
1-(2,3-difluoro-4-methylphenyl)cyclohex-2-en-1-ol (PubChem CID 107512381) has the molecular formula C13H14F2O and a molecular weight of 224.25 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-methylphenyl)cyclohex-2-en-1-ol.
| Compound Name | 1-(2,3-difluoro-4-methylphenyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 107512381 |
| Molecular Formula | C13H14F2O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2,3-difluoro-4-methylphenyl)cyclohex-2-en-1-ol |
| SMILES | Cc1ccc(C2(O)C=CCCC2)c(F)c1F |
| InChI | InChI=1S/C13H14F2O/c1-9-5-6-10(12(15)11(9)14)13(16)7-3-2-4-8-13/h3,5-7,16H,2,4,8H2,1H3 |
| InChIKey | PCPMRPJLGNOYDQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|