C12H12O4 — CID 10751389
(2E,4E)-5-(4-methoxy-3-methyl-6-oxopyran-2-yl)penta-2,4-dienal (PubChem CID 10751389) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (2E,4E)-5-(4-methoxy-3-methyl-6-oxopyran-2-yl)penta-2,4-dienal.
| Compound Name | (2E,4E)-5-(4-methoxy-3-methyl-6-oxopyran-2-yl)penta-2,4-dienal |
|---|---|
| PubChem CID | 10751389 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (2E,4E)-5-(4-methoxy-3-methyl-6-oxopyran-2-yl)penta-2,4-dienal |
| SMILES | COc1cc(=O)oc(/C=C/C=C/C=O)c1C |
| InChI | InChI=1S/C12H12O4/c1-9-10(6-4-3-5-7-13)16-12(14)8-11(9)15-2/h3-8H,1-2H3/b5-3+,6-4+ |
| InChIKey | MLFGJPIHJMFFLG-GGWOSOGESA-N |
| XLogP | 1.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|