C10H7ClF2 — CID 107513987
1-(3-chloroprop-1-ynyl)-2,3-difluoro-4-methylbenzene (PubChem CID 107513987) has the molecular formula C10H7ClF2 and a molecular weight of 200.61 g/mol. Its IUPAC name is 1-(3-chloroprop-1-ynyl)-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-(3-chloroprop-1-ynyl)-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 107513987 |
| Molecular Formula | C10H7ClF2 |
| Molecular Weight | 200.61 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 1-(3-chloroprop-1-ynyl)-2,3-difluoro-4-methylbenzene |
| SMILES | Cc1ccc(C#CCCl)c(F)c1F |
| InChI | InChI=1S/C10H7ClF2/c1-7-4-5-8(3-2-6-11)10(13)9(7)12/h4-5H,6H2,1H3 |
| InChIKey | UYVMMPSLSBPDPO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|