C13H12F2N2 — CID 107514276
3-[(2,3-difluoro-4-methylphenyl)methyl]pyridin-4-amine (PubChem CID 107514276) has the molecular formula C13H12F2N2 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-[(2,3-difluoro-4-methylphenyl)methyl]pyridin-4-amine.
| Compound Name | 3-[(2,3-difluoro-4-methylphenyl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 107514276 |
| Molecular Formula | C13H12F2N2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-[(2,3-difluoro-4-methylphenyl)methyl]pyridin-4-amine |
| SMILES | Cc1ccc(Cc2cnccc2N)c(F)c1F |
| InChI | InChI=1S/C13H12F2N2/c1-8-2-3-9(13(15)12(8)14)6-10-7-17-5-4-11(10)16/h2-5,7H,6H2,1H3,(H2,16,17) |
| InChIKey | JSVOPGZYIWGHAD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |