C14H16N2 — CID 96612968
4-[(2,4-dimethylphenyl)methyl]pyridin-3-amine (PubChem CID 96612968) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenyl)methyl]pyridin-3-amine.
| Compound Name | 4-[(2,4-dimethylphenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 96612968 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4-[(2,4-dimethylphenyl)methyl]pyridin-3-amine |
| SMILES | Cc1ccc(Cc2ccncc2N)c(C)c1 |
| InChI | InChI=1S/C14H16N2/c1-10-3-4-12(11(2)7-10)8-13-5-6-16-9-14(13)15/h3-7,9H,8,15H2,1-2H3 |
| InChIKey | IBVLXQUVOSDVRK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |