C13H14N2S — CID 28890544
4-(2,5-dimethylphenyl)sulfanylpyridin-3-amine (PubChem CID 28890544) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)sulfanylpyridin-3-amine.
| Compound Name | 4-(2,5-dimethylphenyl)sulfanylpyridin-3-amine |
|---|---|
| PubChem CID | 28890544 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-(2,5-dimethylphenyl)sulfanylpyridin-3-amine |
| SMILES | Cc1ccc(C)c(Sc2ccncc2N)c1 |
| InChI | InChI=1S/C13H14N2S/c1-9-3-4-10(2)13(7-9)16-12-5-6-15-8-11(12)14/h3-8H,14H2,1-2H3 |
| InChIKey | HJBHCZLJYWJMOH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |