2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid

C7H6Cl2O4 — CID 10751650

IUPAC2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid
SMILESCC1(CC(=O)O)OC(=O)C(Cl)=C1Cl
InChIInChI=1S/C7H6Cl2O4/c1-7(2-3(10)11)5(9)4(8)6(12)13-7/h2H2,1H3,(H,10,11)
InChIKeyIQGQCYRHKPUGLI-UHFFFAOYSA-N
MW225.03 g/mol
LogP1.47
Rot. Bonds2

About 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid

2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid (PubChem CID 10751650) has the molecular formula C7H6Cl2O4 and a molecular weight of 225.03 g/mol. Its IUPAC name is 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid.

Molecular Properties

Compound Name2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid
PubChem CID10751650
Molecular FormulaC7H6Cl2O4
Molecular Weight225.03 g/mol
Exact Mass223.96
IUPAC Name2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid
SMILESCC1(CC(=O)O)OC(=O)C(Cl)=C1Cl
InChIInChI=1S/C7H6Cl2O4/c1-7(2-3(10)11)5(9)4(8)6(12)13-7/h2H2,1H3,(H,10,11)
InChIKeyIQGQCYRHKPUGLI-UHFFFAOYSA-N
XLogP1.47
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.03
LogP ≤ 51.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid?
The IUPAC name of 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid (CID 10751650) is 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid.
What is the SMILES notation for 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid?
The canonical SMILES for 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid is CC1(CC(=O)O)OC(=O)C(Cl)=C1Cl.
What is the InChIKey of 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid?
The InChIKey is IQGQCYRHKPUGLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2O4/c1-7(2-3(10)11)5(9)4(8)6(12)13-7/h2H2,1H3,(H,10,11).
What are the key properties of 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid?
2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid has a molecular weight of 225.03 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichloro-2-methyl-5-oxofuran-2-yl)acetic acid is sourced from PubChem (CID 10751650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).