C14H18FN3O2 — CID 107522890
1-[2-amino-2-(3-fluorophenyl)ethyl]-4-ethylpiperazine-2,5-dione (PubChem CID 107522890) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is 1-[2-amino-2-(3-fluorophenyl)ethyl]-4-ethylpiperazine-2,5-dione.
| Compound Name | 1-[2-amino-2-(3-fluorophenyl)ethyl]-4-ethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107522890 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 1-[2-amino-2-(3-fluorophenyl)ethyl]-4-ethylpiperazine-2,5-dione |
| SMILES | CCN1CC(=O)N(CC(N)c2cccc(F)c2)CC1=O |
| InChI | InChI=1S/C14H18FN3O2/c1-2-17-8-14(20)18(9-13(17)19)7-12(16)10-4-3-5-11(15)6-10/h3-6,12H,2,7-9,16H2,1H3 |
| InChIKey | NPZABEDBMXJAFP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |