C11H11F6NO — CID 107523834
1-(3-fluorophenyl)-2-(2,2,3,3,3-pentafluoropropoxy)ethanamine (PubChem CID 107523834) has the molecular formula C11H11F6NO and a molecular weight of 287.20 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-(2,2,3,3,3-pentafluoropropoxy)ethanamine.
| Compound Name | 1-(3-fluorophenyl)-2-(2,2,3,3,3-pentafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 107523834 |
| Molecular Formula | C11H11F6NO |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(3-fluorophenyl)-2-(2,2,3,3,3-pentafluoropropoxy)ethanamine |
| SMILES | NC(COCC(F)(F)C(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C11H11F6NO/c12-8-3-1-2-7(4-8)9(18)5-19-6-10(13,14)11(15,16)17/h1-4,9H,5-6,18H2 |
| InChIKey | QVZXPCXLSMXBRJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|