C10H13F2NOS — CID 107524370
2-[2-amino-2-(2,5-difluorophenyl)ethyl]sulfanylethanol (PubChem CID 107524370) has the molecular formula C10H13F2NOS and a molecular weight of 233.28 g/mol. Its IUPAC name is 2-[2-amino-2-(2,5-difluorophenyl)ethyl]sulfanylethanol.
| Compound Name | 2-[2-amino-2-(2,5-difluorophenyl)ethyl]sulfanylethanol |
|---|---|
| PubChem CID | 107524370 |
| Molecular Formula | C10H13F2NOS |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 2-[2-amino-2-(2,5-difluorophenyl)ethyl]sulfanylethanol |
| SMILES | NC(CSCCO)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H13F2NOS/c11-7-1-2-9(12)8(5-7)10(13)6-15-4-3-14/h1-2,5,10,14H,3-4,6,13H2 |
| InChIKey | MCZXOQJDNLHFLD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|