C14H22F2N2S — CID 107525314
2-[2-(diethylamino)ethylsulfanyl]-1-(2,5-difluorophenyl)ethanamine (PubChem CID 107525314) has the molecular formula C14H22F2N2S and a molecular weight of 288.41 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfanyl]-1-(2,5-difluorophenyl)ethanamine.
| Compound Name | 2-[2-(diethylamino)ethylsulfanyl]-1-(2,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107525314 |
| Molecular Formula | C14H22F2N2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfanyl]-1-(2,5-difluorophenyl)ethanamine |
| SMILES | CCN(CC)CCSCC(N)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H22F2N2S/c1-3-18(4-2)7-8-19-10-14(17)12-9-11(15)5-6-13(12)16/h5-6,9,14H,3-4,7-8,10,17H2,1-2H3 |
| InChIKey | AFIJBPDBMPLXCX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|