C13H19ClN2 — CID 10752468
benzyl-[(1R,2R)-1-cyano-2-methylbutyl]azanium chloride (PubChem CID 10752468) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is benzyl-[(1R,2R)-1-cyano-2-methylbutyl]azanium chloride.
| Compound Name | benzyl-[(1R,2R)-1-cyano-2-methylbutyl]azanium chloride |
|---|---|
| PubChem CID | 10752468 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | benzyl-[(1R,2R)-1-cyano-2-methylbutyl]azanium chloride |
| SMILES | CC[C@@H](C)[C@H](C#N)[NH2+]Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C13H18N2.ClH/c1-3-11(2)13(9-14)15-10-12-7-5-4-6-8-12;/h4-8,11,13,15H,3,10H2,1-2H3;1H/t11-,13+;/m1./s1 |
| InChIKey | COEDWUQLTPIGTK-YLAFAASESA-N |
| XLogP | -1.31 |
| TPSA | 40.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |