C13H19NO2 — CID 6994932
(2S,3S)-2-(benzylazaniumyl)-3-methylpentanoate (PubChem CID 6994932) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2S,3S)-2-(benzylazaniumyl)-3-methylpentanoate.
| Compound Name | (2S,3S)-2-(benzylazaniumyl)-3-methylpentanoate |
|---|---|
| PubChem CID | 6994932 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2S,3S)-2-(benzylazaniumyl)-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H]([NH2+]Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C13H19NO2/c1-3-10(2)12(13(15)16)14-9-11-7-5-4-6-8-11/h4-8,10,12,14H,3,9H2,1-2H3,(H,15,16)/t10-,12-/m0/s1 |
| InChIKey | GPAVORZIWQTJJQ-JQWIXIFHSA-N |
| XLogP | -0.09 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |