C12H22O3Si — CID 10752703
[(3E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]buta-1,3-dien-2-yl]oxy-trimethylsilane (PubChem CID 10752703) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is [(3E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]buta-1,3-dien-2-yl]oxy-trimethylsilane.
| Compound Name | [(3E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]buta-1,3-dien-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10752703 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [(3E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]buta-1,3-dien-2-yl]oxy-trimethylsilane |
| SMILES | C=C(/C=C/[C@H]1COC(C)(C)O1)O[Si](C)(C)C |
| InChI | InChI=1S/C12H22O3Si/c1-10(15-16(4,5)6)7-8-11-9-13-12(2,3)14-11/h7-8,11H,1,9H2,2-6H3/b8-7+/t11-/m0/s1 |
| InChIKey | ARJHWCMUPRFRKP-AEZGRPFRSA-N |
| XLogP | 3.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|