C13H12N2O3 — CID 10752794
(E)-3-(5-acetamido-1H-indol-2-yl)prop-2-enoic acid (PubChem CID 10752794) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is (E)-3-(5-acetamido-1H-indol-2-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(5-acetamido-1H-indol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 10752794 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (E)-3-(5-acetamido-1H-indol-2-yl)prop-2-enoic acid |
| SMILES | CC(=O)Nc1ccc2[nH]c(/C=C/C(=O)O)cc2c1 |
| InChI | InChI=1S/C13H12N2O3/c1-8(16)14-10-2-4-12-9(6-10)7-11(15-12)3-5-13(17)18/h2-7,15H,1H3,(H,14,16)(H,17,18)/b5-3+ |
| InChIKey | SWYBZVHYBMBHJS-HWKANZROSA-N |
| XLogP | 2.22 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|