About 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone
1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone (PubChem CID 132942638) has the molecular formula C13H10F3NO
and a molecular weight of 253.22 g/mol. Its IUPAC name is 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone |
| PubChem CID | 132942638 |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone |
| SMILES | CC(=O)c1ccc2[nH]c(/C=C/C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C13H10F3NO/c1-8(18)9-2-3-12-10(6-9)7-11(17-12)4-5-13(14,15)16/h2-7,17H,1H3/b5-4+ |
| InChIKey | YNGPSKHKHWGYGT-SNAWJCMRSA-N |
| XLogP | 3.95 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone?
The IUPAC name of 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone (CID 132942638) is 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone.
What is the SMILES notation for 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone?
The canonical SMILES for 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone is CC(=O)c1ccc2[nH]c(/C=C/C(F)(F)F)cc2c1.
What is the InChIKey of 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone?
The InChIKey is YNGPSKHKHWGYGT-SNAWJCMRSA-N. The full InChI is InChI=1S/C13H10F3NO/c1-8(18)9-2-3-12-10(6-9)7-11(17-12)4-5-13(14,15)16/h2-7,17H,1H3/b5-4+.
What are the key properties of 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone?
1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone has a molecular weight of 253.22 g/mol, XLogP of 3.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(E)-3,3,3-trifluoroprop-1-enyl]-1H-indol-5-yl]ethanone is sourced from PubChem (CID 132942638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).