C22H22N2O3 — CID 161251929
(E)-N-hydroxy-3-[5-[1-(3-methoxy-4,5-dimethylphenyl)ethenyl]-1H-indol-2-yl]prop-2-enamide (PubChem CID 161251929) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[5-[1-(3-methoxy-4,5-dimethylphenyl)ethenyl]-1H-indol-2-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[5-[1-(3-methoxy-4,5-dimethylphenyl)ethenyl]-1H-indol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 161251929 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (E)-N-hydroxy-3-[5-[1-(3-methoxy-4,5-dimethylphenyl)ethenyl]-1H-indol-2-yl]prop-2-enamide |
| SMILES | C=C(c1cc(C)c(C)c(OC)c1)c1ccc2[nH]c(/C=C/C(=O)NO)cc2c1 |
| InChI | InChI=1S/C22H22N2O3/c1-13-9-17(12-21(27-4)14(13)2)15(3)16-5-7-20-18(10-16)11-19(23-20)6-8-22(25)24-26/h5-12,23,26H,3H2,1-2,4H3,(H,24,25)/b8-6+ |
| InChIKey | IEPGOJBRPWYYDN-SOFGYWHQSA-N |
| XLogP | 4.37 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|