C15H21ClFN3 — CID 107527969
3-(aminomethyl)-N-(2-chloro-5-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 107527969) has the molecular formula C15H21ClFN3 and a molecular weight of 297.80 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-chloro-5-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | 3-(aminomethyl)-N-(2-chloro-5-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 107527969 |
| Molecular Formula | C15H21ClFN3 |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3-(aminomethyl)-N-(2-chloro-5-fluorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CN1C2CCC1CC(CN)(Nc1cc(F)ccc1Cl)C2 |
| InChI | InChI=1S/C15H21ClFN3/c1-20-11-3-4-12(20)8-15(7-11,9-18)19-14-6-10(17)2-5-13(14)16/h2,5-6,11-12,19H,3-4,7-9,18H2,1H3 |
| InChIKey | JQHWJRFLNYPCBG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |