C12H16ClFN2S — CID 107527924
3-(aminomethyl)-N-(2-chloro-5-fluorophenyl)thian-3-amine (PubChem CID 107527924) has the molecular formula C12H16ClFN2S and a molecular weight of 274.79 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-chloro-5-fluorophenyl)thian-3-amine.
| Compound Name | 3-(aminomethyl)-N-(2-chloro-5-fluorophenyl)thian-3-amine |
|---|---|
| PubChem CID | 107527924 |
| Molecular Formula | C12H16ClFN2S |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-(aminomethyl)-N-(2-chloro-5-fluorophenyl)thian-3-amine |
| SMILES | NCC1(Nc2cc(F)ccc2Cl)CCCSC1 |
| InChI | InChI=1S/C12H16ClFN2S/c13-10-3-2-9(14)6-11(10)16-12(7-15)4-1-5-17-8-12/h2-3,6,16H,1,4-5,7-8,15H2 |
| InChIKey | VTMHMYHEBRMQGH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |