C14H10BrF2NO2S — CID 107537454
2-(2-bromo-3,4-difluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid (PubChem CID 107537454) has the molecular formula C14H10BrF2NO2S and a molecular weight of 374.21 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107537454 |
| Molecular Formula | C14H10BrF2NO2S |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-4-carboxylic acid |
| SMILES | O=C(O)C1CCCc2sc(-c3ccc(F)c(F)c3Br)nc21 |
| InChI | InChI=1S/C14H10BrF2NO2S/c15-10-6(4-5-8(16)11(10)17)13-18-12-7(14(19)20)2-1-3-9(12)21-13/h4-5,7H,1-3H2,(H,19,20) |
| InChIKey | JTJCFMGAGIXAPE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|