C14H13BrF2N2S — CID 107539603
2-(2-bromo-3,4-difluorophenyl)-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine (PubChem CID 107539603) has the molecular formula C14H13BrF2N2S and a molecular weight of 359.24 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 107539603 |
| Molecular Formula | C14H13BrF2N2S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-N-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-amine |
| SMILES | CNC1CCCc2sc(-c3ccc(F)c(F)c3Br)nc21 |
| InChI | InChI=1S/C14H13BrF2N2S/c1-18-9-3-2-4-10-13(9)19-14(20-10)7-5-6-8(16)12(17)11(7)15/h5-6,9,18H,2-4H2,1H3 |
| InChIKey | WJPJGKDZEJXENI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|