C13H8F3NO2S — CID 107935405
2-(2,3,4-trifluorophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylic acid (PubChem CID 107935405) has the molecular formula C13H8F3NO2S and a molecular weight of 299.27 g/mol. Its IUPAC name is 2-(2,3,4-trifluorophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylic acid.
| Compound Name | 2-(2,3,4-trifluorophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107935405 |
| Molecular Formula | C13H8F3NO2S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2-(2,3,4-trifluorophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-4-carboxylic acid |
| SMILES | O=C(O)C1CCc2sc(-c3ccc(F)c(F)c3F)nc21 |
| InChI | InChI=1S/C13H8F3NO2S/c14-7-3-1-5(9(15)10(7)16)12-17-11-6(13(18)19)2-4-8(11)20-12/h1,3,6H,2,4H2,(H,18,19) |
| InChIKey | DRLWHRKFHQSTGK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|