C14H18BrF2N — CID 107538638
(2-bromo-3,4-difluorophenyl)-(4-methylcyclohexyl)methanamine (PubChem CID 107538638) has the molecular formula C14H18BrF2N and a molecular weight of 318.21 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(4-methylcyclohexyl)methanamine.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(4-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 107538638 |
| Molecular Formula | C14H18BrF2N |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(4-methylcyclohexyl)methanamine |
| SMILES | CC1CCC(C(N)c2ccc(F)c(F)c2Br)CC1 |
| InChI | InChI=1S/C14H18BrF2N/c1-8-2-4-9(5-3-8)14(18)10-6-7-11(16)13(17)12(10)15/h6-9,14H,2-5,18H2,1H3 |
| InChIKey | QCRHXXFENWCUNK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|