C15H16BrF2N3 — CID 107539227
3-[2-(2-bromo-3,4-difluorophenyl)-2-(ethylamino)ethyl]pyridin-4-amine (PubChem CID 107539227) has the molecular formula C15H16BrF2N3 and a molecular weight of 356.21 g/mol. Its IUPAC name is 3-[2-(2-bromo-3,4-difluorophenyl)-2-(ethylamino)ethyl]pyridin-4-amine.
| Compound Name | 3-[2-(2-bromo-3,4-difluorophenyl)-2-(ethylamino)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 107539227 |
| Molecular Formula | C15H16BrF2N3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 3-[2-(2-bromo-3,4-difluorophenyl)-2-(ethylamino)ethyl]pyridin-4-amine |
| SMILES | CCNC(Cc1cnccc1N)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C15H16BrF2N3/c1-2-21-13(7-9-8-20-6-5-12(9)19)10-3-4-11(17)15(18)14(10)16/h3-6,8,13,21H,2,7H2,1H3,(H2,19,20) |
| InChIKey | AYRKXAANNILYFL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|