C12H8Br2N4 — CID 107543940
2-(2,4-dibromoanilino)-6-methylpyrimidine-4-carbonitrile (PubChem CID 107543940) has the molecular formula C12H8Br2N4 and a molecular weight of 368.03 g/mol. Its IUPAC name is 2-(2,4-dibromoanilino)-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-(2,4-dibromoanilino)-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107543940 |
| Molecular Formula | C12H8Br2N4 |
| Molecular Weight | 368.03 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | 2-(2,4-dibromoanilino)-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(Nc2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C12H8Br2N4/c1-7-4-9(6-15)17-12(16-7)18-11-3-2-8(13)5-10(11)14/h2-5H,1H3,(H,16,17,18) |
| InChIKey | ZDIYVIBBQRDBNN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.03 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |