C14H14N4O2 — CID 107543373
2-(3,5-dimethoxyanilino)-6-methylpyrimidine-4-carbonitrile (PubChem CID 107543373) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-(3,5-dimethoxyanilino)-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107543373 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-6-methylpyrimidine-4-carbonitrile |
| SMILES | COc1cc(Nc2nc(C)cc(C#N)n2)cc(OC)c1 |
| InChI | InChI=1S/C14H14N4O2/c1-9-4-11(8-15)18-14(16-9)17-10-5-12(19-2)7-13(6-10)20-3/h4-7H,1-3H3,(H,16,17,18) |
| InChIKey | SPOSKOPLNYQNNT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |