C13H13N5O — CID 107544878
2-[(6-ethoxy-3-pyridinyl)amino]-6-methylpyrimidine-4-carbonitrile (PubChem CID 107544878) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-[(6-ethoxy-3-pyridinyl)amino]-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-[(6-ethoxy-3-pyridinyl)amino]-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107544878 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-[(6-ethoxy-3-pyridinyl)amino]-6-methylpyrimidine-4-carbonitrile |
| SMILES | CCOc1ccc(Nc2nc(C)cc(C#N)n2)cn1 |
| InChI | InChI=1S/C13H13N5O/c1-3-19-12-5-4-10(8-15-12)17-13-16-9(2)6-11(7-14)18-13/h4-6,8H,3H2,1-2H3,(H,16,17,18) |
| InChIKey | PABGXLOVKYWHAE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |