C13H8ClF3N4 — CID 107545343
2-[3-chloro-5-(trifluoromethyl)anilino]-6-methylpyrimidine-4-carbonitrile (PubChem CID 107545343) has the molecular formula C13H8ClF3N4 and a molecular weight of 312.68 g/mol. Its IUPAC name is 2-[3-chloro-5-(trifluoromethyl)anilino]-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-[3-chloro-5-(trifluoromethyl)anilino]-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107545343 |
| Molecular Formula | C13H8ClF3N4 |
| Molecular Weight | 312.68 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[3-chloro-5-(trifluoromethyl)anilino]-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(Nc2cc(Cl)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C13H8ClF3N4/c1-7-2-11(6-18)21-12(19-7)20-10-4-8(13(15,16)17)3-9(14)5-10/h2-5H,1H3,(H,19,20,21) |
| InChIKey | QKGIRTGNBNUQCQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |