C15H18ClN5 — CID 107550456
2-[1-(2-chlorophenyl)ethyl-methylamino]-6-methylpyrimidine-4-carboximidamide (PubChem CID 107550456) has the molecular formula C15H18ClN5 and a molecular weight of 303.80 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)ethyl-methylamino]-6-methylpyrimidine-4-carboximidamide.
| Compound Name | 2-[1-(2-chlorophenyl)ethyl-methylamino]-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550456 |
| Molecular Formula | C15H18ClN5 |
| Molecular Weight | 303.80 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-[1-(2-chlorophenyl)ethyl-methylamino]-6-methylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(N(C)C(C)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H18ClN5/c1-9-8-13(14(17)18)20-15(19-9)21(3)10(2)11-6-4-5-7-12(11)16/h4-8,10H,1-3H3,(H3,17,18) |
| InChIKey | LEUMKWQQKLQNCZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|