About 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile
6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile (PubChem CID 107551349) has the molecular formula C10H8N4S2
and a molecular weight of 248.34 g/mol. Its IUPAC name is 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile |
| PubChem CID | 107551349 |
| Molecular Formula | C10H8N4S2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(Sc2nc(C)cs2)n1 |
| InChI | InChI=1S/C10H8N4S2/c1-6-3-8(4-11)14-9(12-6)16-10-13-7(2)5-15-10/h3,5H,1-2H3 |
| InChIKey | CTYDYQZHPKUDDO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile?
The IUPAC name of 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile (CID 107551349) is 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile.
What is the SMILES notation for 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile?
The canonical SMILES for 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile is Cc1cc(C#N)nc(Sc2nc(C)cs2)n1.
What is the InChIKey of 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile?
The InChIKey is CTYDYQZHPKUDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4S2/c1-6-3-8(4-11)14-9(12-6)16-10-13-7(2)5-15-10/h3,5H,1-2H3.
What are the key properties of 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile?
6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile has a molecular weight of 248.34 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]pyrimidine-4-carbonitrile is sourced from PubChem (CID 107551349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).