C19H36O — CID 10755238
(7R,9S,11S)-7,11-dimethylheptadec-5-yn-9-ol (PubChem CID 10755238) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is (7R,9S,11S)-7,11-dimethylheptadec-5-yn-9-ol.
| Compound Name | (7R,9S,11S)-7,11-dimethylheptadec-5-yn-9-ol |
|---|---|
| PubChem CID | 10755238 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | (7R,9S,11S)-7,11-dimethylheptadec-5-yn-9-ol |
| SMILES | CCCCC#C[C@H](C)C[C@@H](O)C[C@@H](C)CCCCCC |
| InChI | InChI=1S/C19H36O/c1-5-7-9-11-13-17(3)15-19(20)16-18(4)14-12-10-8-6-2/h17-20H,5-11,13,15-16H2,1-4H3/t17-,18-,19-/m0/s1 |
| InChIKey | WGKAYBJHKJFXGA-FHWLQOOXSA-N |
| XLogP | 5.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|