About 9-methylhexadec-5-yne
9-methylhexadec-5-yne (PubChem CID 22223866) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is 9-methylhexadec-5-yne.
Molecular Properties
| Compound Name | 9-methylhexadec-5-yne |
| PubChem CID | 22223866 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 9-methylhexadec-5-yne |
| SMILES | CCCCC#CCCC(C)CCCCCCC |
| InChI | InChI=1S/C17H32/c1-4-6-8-10-12-14-16-17(3)15-13-11-9-7-5-2/h17H,4-9,11,13-16H2,1-3H3 |
| InChIKey | CLQGIPMFOQTQIJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-methylhexadec-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylhexadec-5-yne?
The IUPAC name of 9-methylhexadec-5-yne (CID 22223866) is 9-methylhexadec-5-yne.
What is the SMILES notation for 9-methylhexadec-5-yne?
The canonical SMILES for 9-methylhexadec-5-yne is CCCCC#CCCC(C)CCCCCCC.
What is the InChIKey of 9-methylhexadec-5-yne?
The InChIKey is CLQGIPMFOQTQIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32/c1-4-6-8-10-12-14-16-17(3)15-13-11-9-7-5-2/h17H,4-9,11,13-16H2,1-3H3.
What are the key properties of 9-methylhexadec-5-yne?
9-methylhexadec-5-yne has a molecular weight of 236.44 g/mol, XLogP of 5.96, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylhexadec-5-yne is sourced from PubChem (CID 22223866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).