About 12-methylpentadec-6-yne
12-methylpentadec-6-yne (PubChem CID 142980159) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is 12-methylpentadec-6-yne.
Molecular Properties
| Compound Name | 12-methylpentadec-6-yne |
| PubChem CID | 142980159 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 12-methylpentadec-6-yne |
| SMILES | CCCCCC#CCCCCC(C)CCC |
| InChI | InChI=1S/C16H30/c1-4-6-7-8-9-10-11-12-13-15-16(3)14-5-2/h16H,4-8,11-15H2,1-3H3 |
| InChIKey | LPZZGQPLMZWDKD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 12-methylpentadec-6-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methylpentadec-6-yne?
The IUPAC name of 12-methylpentadec-6-yne (CID 142980159) is 12-methylpentadec-6-yne.
What is the SMILES notation for 12-methylpentadec-6-yne?
The canonical SMILES for 12-methylpentadec-6-yne is CCCCCC#CCCCCC(C)CCC.
What is the InChIKey of 12-methylpentadec-6-yne?
The InChIKey is LPZZGQPLMZWDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30/c1-4-6-7-8-9-10-11-12-13-15-16(3)14-5-2/h16H,4-8,11-15H2,1-3H3.
What are the key properties of 12-methylpentadec-6-yne?
12-methylpentadec-6-yne has a molecular weight of 222.42 g/mol, XLogP of 5.57, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methylpentadec-6-yne is sourced from PubChem (CID 142980159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).