About 10-methylheptadec-3-yne
10-methylheptadec-3-yne (PubChem CID 22224077) has the molecular formula C18H34
and a molecular weight of 250.47 g/mol. Its IUPAC name is 10-methylheptadec-3-yne.
Molecular Properties
| Compound Name | 10-methylheptadec-3-yne |
| PubChem CID | 22224077 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 10-methylheptadec-3-yne |
| SMILES | CCC#CCCCCCC(C)CCCCCCC |
| InChI | InChI=1S/C18H34/c1-4-6-8-10-11-13-15-17-18(3)16-14-12-9-7-5-2/h18H,4-5,7,9-17H2,1-3H3 |
| InChIKey | XOYUDFLNYJDJIC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-methylheptadec-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylheptadec-3-yne?
The IUPAC name of 10-methylheptadec-3-yne (CID 22224077) is 10-methylheptadec-3-yne.
What is the SMILES notation for 10-methylheptadec-3-yne?
The canonical SMILES for 10-methylheptadec-3-yne is CCC#CCCCCCC(C)CCCCCCC.
What is the InChIKey of 10-methylheptadec-3-yne?
The InChIKey is XOYUDFLNYJDJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34/c1-4-6-8-10-11-13-15-17-18(3)16-14-12-9-7-5-2/h18H,4-5,7,9-17H2,1-3H3.
What are the key properties of 10-methylheptadec-3-yne?
10-methylheptadec-3-yne has a molecular weight of 250.47 g/mol, XLogP of 6.35, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylheptadec-3-yne is sourced from PubChem (CID 22224077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).