About 8-methyltridec-5-yne
8-methyltridec-5-yne (PubChem CID 173074728) has the molecular formula C14H26
and a molecular weight of 194.36 g/mol. Its IUPAC name is 8-methyltridec-5-yne.
Molecular Properties
| Compound Name | 8-methyltridec-5-yne |
| PubChem CID | 173074728 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 8-methyltridec-5-yne |
| SMILES | CCCCC#CCC(C)CCCCC |
| InChI | InChI=1S/C14H26/c1-4-6-8-9-11-13-14(3)12-10-7-5-2/h14H,4-8,10,12-13H2,1-3H3 |
| InChIKey | JMPNLSAJODOYAX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-methyltridec-5-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyltridec-5-yne?
The IUPAC name of 8-methyltridec-5-yne (CID 173074728) is 8-methyltridec-5-yne.
What is the SMILES notation for 8-methyltridec-5-yne?
The canonical SMILES for 8-methyltridec-5-yne is CCCCC#CCC(C)CCCCC.
What is the InChIKey of 8-methyltridec-5-yne?
The InChIKey is JMPNLSAJODOYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26/c1-4-6-8-9-11-13-14(3)12-10-7-5-2/h14H,4-8,10,12-13H2,1-3H3.
What are the key properties of 8-methyltridec-5-yne?
8-methyltridec-5-yne has a molecular weight of 194.36 g/mol, XLogP of 4.79, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyltridec-5-yne is sourced from PubChem (CID 173074728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).