C14H19N5 — CID 107552616
2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-methylpyrimidine-4-carbonitrile (PubChem CID 107552616) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107552616 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-6-methylpyrimidine-4-carbonitrile |
| SMILES | CCC1C2CNCC2CN1c1nc(C)cc(C#N)n1 |
| InChI | InChI=1S/C14H19N5/c1-3-13-12-7-16-6-10(12)8-19(13)14-17-9(2)4-11(5-15)18-14/h4,10,12-13,16H,3,6-8H2,1-2H3 |
| InChIKey | RBHMVGXPMBDDPT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |