C15H15ClFNOS — CID 107558290
N-[[5-[(2-chloro-4-fluorophenoxy)methyl]thiophen-2-yl]methyl]cyclopropanamine (PubChem CID 107558290) has the molecular formula C15H15ClFNOS and a molecular weight of 311.81 g/mol. Its IUPAC name is N-[[5-[(2-chloro-4-fluorophenoxy)methyl]thiophen-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-[(2-chloro-4-fluorophenoxy)methyl]thiophen-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107558290 |
| Molecular Formula | C15H15ClFNOS |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[[5-[(2-chloro-4-fluorophenoxy)methyl]thiophen-2-yl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(OCc2ccc(CNC3CC3)s2)c(Cl)c1 |
| InChI | InChI=1S/C15H15ClFNOS/c16-14-7-10(17)1-6-15(14)19-9-13-5-4-12(20-13)8-18-11-2-3-11/h1,4-7,11,18H,2-3,8-9H2 |
| InChIKey | PDCLQYSEDOJIOO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |