C15H15BrFNOS — CID 107696476
N-[[2-[(4-bromothiophen-2-yl)methoxy]-5-fluorophenyl]methyl]cyclopropanamine (PubChem CID 107696476) has the molecular formula C15H15BrFNOS and a molecular weight of 356.26 g/mol. Its IUPAC name is N-[[2-[(4-bromothiophen-2-yl)methoxy]-5-fluorophenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-[(4-bromothiophen-2-yl)methoxy]-5-fluorophenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107696476 |
| Molecular Formula | C15H15BrFNOS |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | N-[[2-[(4-bromothiophen-2-yl)methoxy]-5-fluorophenyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(OCc2cc(Br)cs2)c(CNC2CC2)c1 |
| InChI | InChI=1S/C15H15BrFNOS/c16-11-6-14(20-9-11)8-19-15-4-1-12(17)5-10(15)7-18-13-2-3-13/h1,4-6,9,13,18H,2-3,7-8H2 |
| InChIKey | JITAPDWGCBWSQQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |