C17H28N2O2 — CID 10756080
ethyl (1S,2R,3R,6S,7S,8R)-3,6,12,12-tetramethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 10756080) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is ethyl (1S,2R,3R,6S,7S,8R)-3,6,12,12-tetramethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | ethyl (1S,2R,3R,6S,7S,8R)-3,6,12,12-tetramethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 10756080 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | ethyl (1S,2R,3R,6S,7S,8R)-3,6,12,12-tetramethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CCOC(=O)N1N[C@@]2(C)[C@H]3[C@@H]4CC[C@@H](C4)[C@H]3[C@]1(C)C2(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-6-21-14(20)19-17(5)13-11-8-7-10(9-11)12(13)16(4,18-19)15(17,2)3/h10-13,18H,6-9H2,1-5H3/t10-,11+,12+,13-,16+,17-/m1/s1 |
| InChIKey | WPKNTURGUIPLFK-PHOOHRJXSA-N |
| XLogP | 3.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|