C14H18N2O3 — CID 107566796
(2R)-2-(1,3-dihydroisoindole-2-carbonylamino)pentanoic acid (PubChem CID 107566796) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is (2R)-2-(1,3-dihydroisoindole-2-carbonylamino)pentanoic acid.
| Compound Name | (2R)-2-(1,3-dihydroisoindole-2-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 107566796 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (2R)-2-(1,3-dihydroisoindole-2-carbonylamino)pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)N1Cc2ccccc2C1)C(=O)O |
| InChI | InChI=1S/C14H18N2O3/c1-2-5-12(13(17)18)15-14(19)16-8-10-6-3-4-7-11(10)9-16/h3-4,6-7,12H,2,5,8-9H2,1H3,(H,15,19)(H,17,18)/t12-/m1/s1 |
| InChIKey | QXLQUHWSMSFHOM-GFCCVEGCSA-N |
| XLogP | 1.97 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |