C14H24N4O3 — CID 107567749
(2R)-2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoylamino]pentanoic acid (PubChem CID 107567749) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2R)-2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoylamino]pentanoic acid.
| Compound Name | (2R)-2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107567749 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R)-2-[3-(3,5-dimethylpyrazol-1-yl)propylcarbamoylamino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)NCCCn1nc(C)cc1C)C(=O)O |
| InChI | InChI=1S/C14H24N4O3/c1-4-6-12(13(19)20)16-14(21)15-7-5-8-18-11(3)9-10(2)17-18/h9,12H,4-8H2,1-3H3,(H,19,20)(H2,15,16,21)/t12-/m1/s1 |
| InChIKey | QKSFRIOYCVWGLH-GFCCVEGCSA-N |
| XLogP | 1.44 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|