C9H16N4O2 — CID 107567893
ethyl 5-[(1S)-1-aminobutyl]-1H-1,2,4-triazole-3-carboxylate (PubChem CID 107567893) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is ethyl 5-[(1S)-1-aminobutyl]-1H-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 5-[(1S)-1-aminobutyl]-1H-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 107567893 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | ethyl 5-[(1S)-1-aminobutyl]-1H-1,2,4-triazole-3-carboxylate |
| SMILES | CCC[C@H](N)c1nc(C(=O)OCC)n[nH]1 |
| InChI | InChI=1S/C9H16N4O2/c1-3-5-6(10)7-11-8(13-12-7)9(14)15-4-2/h6H,3-5,10H2,1-2H3,(H,11,12,13)/t6-/m0/s1 |
| InChIKey | ODXWHZBPTUVRNX-LURJTMIESA-N |
| XLogP | 0.78 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |