About ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate
ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate (PubChem CID 66290073) has the molecular formula C7H12N4O3
and a molecular weight of 200.20 g/mol. Its IUPAC name is ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate |
| PubChem CID | 66290073 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c(C(O)CN)n1 |
| InChI | InChI=1S/C7H12N4O3/c1-2-14-7(13)6-9-5(10-11-6)4(12)3-8/h4,12H,2-3,8H2,1H3,(H,9,10,11) |
| InChIKey | USFXZMFCKMWXFP-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate?
The IUPAC name of ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate (CID 66290073) is ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate?
The canonical SMILES for ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate is CCOC(=O)c1n[nH]c(C(O)CN)n1.
What is the InChIKey of ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate?
The InChIKey is USFXZMFCKMWXFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O3/c1-2-14-7(13)6-9-5(10-11-6)4(12)3-8/h4,12H,2-3,8H2,1H3,(H,9,10,11).
What are the key properties of ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate?
ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate has a molecular weight of 200.20 g/mol, XLogP of -1.03, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2-amino-1-hydroxyethyl)-1H-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 66290073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).