C9H15N3O3 — CID 79200370
ethyl 5-(3-hydroxybutyl)-1H-1,2,4-triazole-3-carboxylate (PubChem CID 79200370) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is ethyl 5-(3-hydroxybutyl)-1H-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 5-(3-hydroxybutyl)-1H-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 79200370 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | ethyl 5-(3-hydroxybutyl)-1H-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c(CCC(C)O)n1 |
| InChI | InChI=1S/C9H15N3O3/c1-3-15-9(14)8-10-7(11-12-8)5-4-6(2)13/h6,13H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | WCNPTSJONRQQBU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |